C19H28N6O — CID 111243033
N-ethyl-N'-(2-imidazol-1-ylethyl)-4-(4-methoxyphenyl)piperazine-1-carboximidamide (PubChem CID 111243033) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is N-ethyl-N'-(2-imidazol-1-ylethyl)-4-(4-methoxyphenyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(2-imidazol-1-ylethyl)-4-(4-methoxyphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111243033 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | N-ethyl-N'-(2-imidazol-1-ylethyl)-4-(4-methoxyphenyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCn1ccnc1)N1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C19H28N6O/c1-3-21-19(22-9-11-23-10-8-20-16-23)25-14-12-24(13-15-25)17-4-6-18(26-2)7-5-17/h4-8,10,16H,3,9,11-15H2,1-2H3,(H,21,22) |
| InChIKey | FTBYMXHMTVNBST-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|