C22H34N6O — CID 111242405
N-ethyl-4-(4-methoxyphenyl)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 111242405) has the molecular formula C22H34N6O and a molecular weight of 398.56 g/mol. Its IUPAC name is N-ethyl-4-(4-methoxyphenyl)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(4-methoxyphenyl)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111242405 |
| Molecular Formula | C22H34N6O |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | N-ethyl-4-(4-methoxyphenyl)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1c(C)nn(C)c1C)N1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C22H34N6O/c1-6-23-22(24-12-11-21-17(2)25-26(4)18(21)3)28-15-13-27(14-16-28)19-7-9-20(29-5)10-8-19/h7-10H,6,11-16H2,1-5H3,(H,23,24) |
| InChIKey | BEYWHIQBZXDYKV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|