C21H31ClN6 — CID 111186613
4-(3-chlorophenyl)-N-ethyl-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 111186613) has the molecular formula C21H31ClN6 and a molecular weight of 402.97 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N-ethyl-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-(3-chlorophenyl)-N-ethyl-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111186613 |
| Molecular Formula | C21H31ClN6 |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 4-(3-chlorophenyl)-N-ethyl-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1c(C)nn(C)c1C)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H31ClN6/c1-5-23-21(24-10-9-20-16(2)25-26(4)17(20)3)28-13-11-27(12-14-28)19-8-6-7-18(22)15-19/h6-8,15H,5,9-14H2,1-4H3,(H,23,24) |
| InChIKey | YEBRRWLQCIUVPX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|