C16H24ClIN4 — CID 111186488
4-(3-chlorophenyl)-N-ethyl-N'-prop-2-enylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111186488) has the molecular formula C16H24ClIN4 and a molecular weight of 434.75 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N-ethyl-N'-prop-2-enylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(3-chlorophenyl)-N-ethyl-N'-prop-2-enylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111186488 |
| Molecular Formula | C16H24ClIN4 |
| Molecular Weight | 434.75 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 4-(3-chlorophenyl)-N-ethyl-N'-prop-2-enylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C=CC/N=C(\NCC)N1CCN(c2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C16H23ClN4.HI/c1-3-8-19-16(18-4-2)21-11-9-20(10-12-21)15-7-5-6-14(17)13-15;/h3,5-7,13H,1,4,8-12H2,2H3,(H,18,19);1H |
| InChIKey | ILXAKHBVIUNLAZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.75 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|