C19H30ClN5O — CID 111186955
4-(3-chlorophenyl)-N-ethyl-N'-(2-morpholin-4-ylethyl)piperazine-1-carboximidamide (PubChem CID 111186955) has the molecular formula C19H30ClN5O and a molecular weight of 379.94 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N-ethyl-N'-(2-morpholin-4-ylethyl)piperazine-1-carboximidamide.
| Compound Name | 4-(3-chlorophenyl)-N-ethyl-N'-(2-morpholin-4-ylethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111186955 |
| Molecular Formula | C19H30ClN5O |
| Molecular Weight | 379.94 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 4-(3-chlorophenyl)-N-ethyl-N'-(2-morpholin-4-ylethyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCN1CCOCC1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H30ClN5O/c1-2-21-19(22-6-7-23-12-14-26-15-13-23)25-10-8-24(9-11-25)18-5-3-4-17(20)16-18/h3-5,16H,2,6-15H2,1H3,(H,21,22) |
| InChIKey | AAUFYRCAFITZRL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.94 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|