C15H24ClIN4 — CID 111186688
4-(3-chlorophenyl)-N'-methyl-N-propylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111186688) has the molecular formula C15H24ClIN4 and a molecular weight of 422.74 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N'-methyl-N-propylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(3-chlorophenyl)-N'-methyl-N-propylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111186688 |
| Molecular Formula | C15H24ClIN4 |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 4-(3-chlorophenyl)-N'-methyl-N-propylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCCN/C(=N\C)N1CCN(c2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C15H23ClN4.HI/c1-3-7-18-15(17-2)20-10-8-19(9-11-20)14-6-4-5-13(16)12-14;/h4-6,12H,3,7-11H2,1-2H3,(H,17,18);1H |
| InChIKey | BGPDUMCXEHIRAF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|