C19H25ClIN5 — CID 111186842
4-(3-chlorophenyl)-N'-methyl-N-(2-pyridin-3-ylethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111186842) has the molecular formula C19H25ClIN5 and a molecular weight of 485.80 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N'-methyl-N-(2-pyridin-3-ylethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(3-chlorophenyl)-N'-methyl-N-(2-pyridin-3-ylethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111186842 |
| Molecular Formula | C19H25ClIN5 |
| Molecular Weight | 485.80 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 4-(3-chlorophenyl)-N'-methyl-N-(2-pyridin-3-ylethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCc1cccnc1)N1CCN(c2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C19H24ClN5.HI/c1-21-19(23-9-7-16-4-3-8-22-15-16)25-12-10-24(11-13-25)18-6-2-5-17(20)14-18;/h2-6,8,14-15H,7,9-13H2,1H3,(H,21,23);1H |
| InChIKey | QWPSGWKBLXEKSZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.80 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|