C22H31ClN8 — CID 111186935
4-(3-chlorophenyl)-N'-methyl-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 111186935) has the molecular formula C22H31ClN8 and a molecular weight of 443.00 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N'-methyl-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-(3-chlorophenyl)-N'-methyl-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111186935 |
| Molecular Formula | C22H31ClN8 |
| Molecular Weight | 443.00 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 4-(3-chlorophenyl)-N'-methyl-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCN1CCN(c2ncccn2)CC1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H31ClN8/c1-24-21(30-16-14-29(15-17-30)20-5-2-4-19(23)18-20)27-8-9-28-10-12-31(13-11-28)22-25-6-3-7-26-22/h2-7,18H,8-17H2,1H3,(H,24,27) |
| InChIKey | XENQICBAGUUQTH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.00 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|