C18H31N7O — CID 111206858
N'-methyl-N-(4-morpholin-4-ylbutyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111206858) has the molecular formula C18H31N7O and a molecular weight of 361.49 g/mol. Its IUPAC name is N'-methyl-N-(4-morpholin-4-ylbutyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-(4-morpholin-4-ylbutyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111206858 |
| Molecular Formula | C18H31N7O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | N'-methyl-N-(4-morpholin-4-ylbutyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCCN1CCOCC1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H31N7O/c1-19-17(20-5-2-3-8-23-13-15-26-16-14-23)24-9-11-25(12-10-24)18-21-6-4-7-22-18/h4,6-7H,2-3,5,8-16H2,1H3,(H,19,20) |
| InChIKey | LHRSGQMOZNGVFR-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|