C23H34N8O — CID 111186234
4-(2-hydroxyphenyl)-N'-methyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]piperazine-1-carboximidamide (PubChem CID 111186234) has the molecular formula C23H34N8O and a molecular weight of 438.58 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-N'-methyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2-hydroxyphenyl)-N'-methyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111186234 |
| Molecular Formula | C23H34N8O |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | 4-(2-hydroxyphenyl)-N'-methyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCN1CCN(c2ncccn2)CC1)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C23H34N8O/c1-24-22(30-18-16-29(17-19-30)20-6-2-3-7-21(20)32)25-10-5-11-28-12-14-31(15-13-28)23-26-8-4-9-27-23/h2-4,6-9,32H,5,10-19H2,1H3,(H,24,25) |
| InChIKey | UXZWMMCWNJDWMP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|