C23H33N7 — CID 111723831
N'-methyl-3-phenyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide (PubChem CID 111723831) has the molecular formula C23H33N7 and a molecular weight of 407.57 g/mol. Its IUPAC name is N'-methyl-3-phenyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-3-phenyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111723831 |
| Molecular Formula | C23H33N7 |
| Molecular Weight | 407.57 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | N'-methyl-3-phenyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCN1CCN(c2ncccn2)CC1)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C23H33N7/c1-24-22(30-14-9-21(19-30)20-7-3-2-4-8-20)25-12-6-13-28-15-17-29(18-16-28)23-26-10-5-11-27-23/h2-5,7-8,10-11,21H,6,9,12-19H2,1H3,(H,24,25) |
| InChIKey | OZMOIRSXXNNXCK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.57 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|