C21H28IN3 — CID 111724300
N'-methyl-3-phenyl-N-(3-phenylpropyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111724300) has the molecular formula C21H28IN3 and a molecular weight of 449.38 g/mol. Its IUPAC name is N'-methyl-3-phenyl-N-(3-phenylpropyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-3-phenyl-N-(3-phenylpropyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111724300 |
| Molecular Formula | C21H28IN3 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | N'-methyl-3-phenyl-N-(3-phenylpropyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCc1ccccc1)N1CCC(c2ccccc2)C1.I |
| InChI | InChI=1S/C21H27N3.HI/c1-22-21(23-15-8-11-18-9-4-2-5-10-18)24-16-14-20(17-24)19-12-6-3-7-13-19;/h2-7,9-10,12-13,20H,8,11,14-17H2,1H3,(H,22,23);1H |
| InChIKey | FSQYEAQFODLXNX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|