C14H21N3 — CID 111722745
N-ethyl-N'-methyl-3-phenylpyrrolidine-1-carboximidamide (PubChem CID 111722745) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is N-ethyl-N'-methyl-3-phenylpyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-methyl-3-phenylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111722745 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | N-ethyl-N'-methyl-3-phenylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\C)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C14H21N3/c1-3-16-14(15-2)17-10-9-13(11-17)12-7-5-4-6-8-12/h4-8,13H,3,9-11H2,1-2H3,(H,15,16) |
| InChIKey | SHIZXJZPSBQKTK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|