C18H29N3O — CID 111724061
N-(2-butoxyethyl)-N'-methyl-3-phenylpyrrolidine-1-carboximidamide (PubChem CID 111724061) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is N-(2-butoxyethyl)-N'-methyl-3-phenylpyrrolidine-1-carboximidamide.
| Compound Name | N-(2-butoxyethyl)-N'-methyl-3-phenylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111724061 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | N-(2-butoxyethyl)-N'-methyl-3-phenylpyrrolidine-1-carboximidamide |
| SMILES | CCCCOCCN/C(=N\C)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C18H29N3O/c1-3-4-13-22-14-11-20-18(19-2)21-12-10-17(15-21)16-8-6-5-7-9-16/h5-9,17H,3-4,10-15H2,1-2H3,(H,19,20) |
| InChIKey | WAYILRVTLIEAMB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|