C15H21F3IN3 — CID 111992856
N'-methyl-3-phenyl-N-(3,3,3-trifluoropropyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111992856) has the molecular formula C15H21F3IN3 and a molecular weight of 427.25 g/mol. Its IUPAC name is N'-methyl-3-phenyl-N-(3,3,3-trifluoropropyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-3-phenyl-N-(3,3,3-trifluoropropyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111992856 |
| Molecular Formula | C15H21F3IN3 |
| Molecular Weight | 427.25 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | N'-methyl-3-phenyl-N-(3,3,3-trifluoropropyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)N1CCC(c2ccccc2)C1.I |
| InChI | InChI=1S/C15H20F3N3.HI/c1-19-14(20-9-8-15(16,17)18)21-10-7-13(11-21)12-5-3-2-4-6-12;/h2-6,13H,7-11H2,1H3,(H,19,20);1H |
| InChIKey | FGMMPZYNJMQPEV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|