C23H33N7 — CID 111723605
N-ethyl-3-phenyl-N'-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]pyrrolidine-1-carboximidamide (PubChem CID 111723605) has the molecular formula C23H33N7 and a molecular weight of 407.57 g/mol. Its IUPAC name is N-ethyl-3-phenyl-N'-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-phenyl-N'-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111723605 |
| Molecular Formula | C23H33N7 |
| Molecular Weight | 407.57 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | N-ethyl-3-phenyl-N'-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCN1CCN(c2ncccn2)CC1)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C23H33N7/c1-2-24-22(30-13-9-21(19-30)20-7-4-3-5-8-20)27-12-14-28-15-17-29(18-16-28)23-25-10-6-11-26-23/h3-8,10-11,21H,2,9,12-19H2,1H3,(H,24,27) |
| InChIKey | JZNQZMDZZGSZIL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.57 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|