C25H37N7 — CID 111725647
3-benzyl-N-ethyl-N'-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide (PubChem CID 111725647) has the molecular formula C25H37N7 and a molecular weight of 435.62 g/mol. Its IUPAC name is 3-benzyl-N-ethyl-N'-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide.
| Compound Name | 3-benzyl-N-ethyl-N'-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111725647 |
| Molecular Formula | C25H37N7 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | 3-benzyl-N-ethyl-N'-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCN1CCN(c2ncccn2)CC1)N1CCC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C25H37N7/c1-2-26-24(32-15-10-23(21-32)20-22-8-4-3-5-9-22)29-13-7-14-30-16-18-31(19-17-30)25-27-11-6-12-28-25/h3-6,8-9,11-12,23H,2,7,10,13-21H2,1H3,(H,26,29) |
| InChIKey | YAGCSUXEWFNQIW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|