C17H23ClN6O — CID 111186759
4-(3-chlorophenyl)-N'-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 111186759) has the molecular formula C17H23ClN6O and a molecular weight of 362.87 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N'-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-(3-chlorophenyl)-N'-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111186759 |
| Molecular Formula | C17H23ClN6O |
| Molecular Weight | 362.87 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 4-(3-chlorophenyl)-N'-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCc1nc(C)no1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H23ClN6O/c1-13-21-16(25-22-13)6-7-20-17(19-2)24-10-8-23(9-11-24)15-5-3-4-14(18)12-15/h3-5,12H,6-11H2,1-2H3,(H,19,20) |
| InChIKey | YMRWSTHESJYEFH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.87 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|