C16H22N6O — CID 110962137
N'-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenylpiperazine-1-carboximidamide (PubChem CID 110962137) has the molecular formula C16H22N6O and a molecular weight of 314.39 g/mol. Its IUPAC name is N'-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenylpiperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110962137 |
| Molecular Formula | C16H22N6O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | N'-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1nc(C)no1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C16H22N6O/c1-13-19-15(23-20-13)12-18-16(17-2)22-10-8-21(9-11-22)14-6-4-3-5-7-14/h3-7H,8-12H2,1-2H3,(H,17,18) |
| InChIKey | MCJPDDXDZUVUEY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|