C20H30N6O2 — CID 111520975
N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-N'-methyl-4-(3-methylphenyl)piperazine-1-carboximidamide (PubChem CID 111520975) has the molecular formula C20H30N6O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-N'-methyl-4-(3-methylphenyl)piperazine-1-carboximidamide.
| Compound Name | N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-N'-methyl-4-(3-methylphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111520975 |
| Molecular Formula | C20H30N6O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | N-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-N'-methyl-4-(3-methylphenyl)piperazine-1-carboximidamide |
| SMILES | CCOC(C)c1noc(CN/C(=N\C)N2CCN(c3cccc(C)c3)CC2)n1 |
| InChI | InChI=1S/C20H30N6O2/c1-5-27-16(3)19-23-18(28-24-19)14-22-20(21-4)26-11-9-25(10-12-26)17-8-6-7-15(2)13-17/h6-8,13,16H,5,9-12,14H2,1-4H3,(H,21,22) |
| InChIKey | YYCFSPZRSBEMBO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|