C18H28IN5O2S — CID 111518212
1-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-[2-(4-methylphenyl)sulfanylethyl]guanidine;hydroiodide (PubChem CID 111518212) has the molecular formula C18H28IN5O2S and a molecular weight of 505.43 g/mol. Its IUPAC name is 1-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-[2-(4-methylphenyl)sulfanylethyl]guanidine;hydroiodide.
| Compound Name | 1-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-[2-(4-methylphenyl)sulfanylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111518212 |
| Molecular Formula | C18H28IN5O2S |
| Molecular Weight | 505.43 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 1-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-[2-(4-methylphenyl)sulfanylethyl]guanidine;hydroiodide |
| SMILES | CCOC(C)c1noc(CN/C(=N\C)NCCSc2ccc(C)cc2)n1.I |
| InChI | InChI=1S/C18H27N5O2S.HI/c1-5-24-14(3)17-22-16(25-23-17)12-21-18(19-4)20-10-11-26-15-8-6-13(2)7-9-15;/h6-9,14H,5,10-12H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | YYAFGUKTPYKHJG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|