C17H26IN5OS — CID 111554260
2-methyl-1-(2-phenylsulfanylethyl)-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide (PubChem CID 111554260) has the molecular formula C17H26IN5OS and a molecular weight of 475.40 g/mol. Its IUPAC name is 2-methyl-1-(2-phenylsulfanylethyl)-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-phenylsulfanylethyl)-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111554260 |
| Molecular Formula | C17H26IN5OS |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 2-methyl-1-(2-phenylsulfanylethyl)-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCSc1ccccc1)NCCc1nc(C(C)C)no1.I |
| InChI | InChI=1S/C17H25N5OS.HI/c1-13(2)16-21-15(23-22-16)9-10-19-17(18-3)20-11-12-24-14-7-5-4-6-8-14;/h4-8,13H,9-12H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | ODQUCGOCSAJUAV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|