C23H29FIN5O2 — CID 111981792
1-[2-(3-fluoro-4-phenoxyphenyl)ethyl]-2-methyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide (PubChem CID 111981792) has the molecular formula C23H29FIN5O2 and a molecular weight of 553.42 g/mol. Its IUPAC name is 1-[2-(3-fluoro-4-phenoxyphenyl)ethyl]-2-methyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-fluoro-4-phenoxyphenyl)ethyl]-2-methyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111981792 |
| Molecular Formula | C23H29FIN5O2 |
| Molecular Weight | 553.42 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 1-[2-(3-fluoro-4-phenoxyphenyl)ethyl]-2-methyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(Oc2ccccc2)c(F)c1)NCCc1nc(C(C)C)no1.I |
| InChI | InChI=1S/C23H28FN5O2.HI/c1-16(2)22-28-21(31-29-22)12-14-27-23(25-3)26-13-11-17-9-10-20(19(24)15-17)30-18-7-5-4-6-8-18;/h4-10,15-16H,11-14H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | XPWNQYOLUKRAHC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|