C17H23F2N5O2 — CID 111981653
1-[2-(2,4-difluorophenoxy)ethyl]-2-methyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine (PubChem CID 111981653) has the molecular formula C17H23F2N5O2 and a molecular weight of 367.40 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenoxy)ethyl]-2-methyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine.
| Compound Name | 1-[2-(2,4-difluorophenoxy)ethyl]-2-methyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111981653 |
| Molecular Formula | C17H23F2N5O2 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 1-[2-(2,4-difluorophenoxy)ethyl]-2-methyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine |
| SMILES | C/N=C(/NCCOc1ccc(F)cc1F)NCCc1nc(C(C)C)no1 |
| InChI | InChI=1S/C17H23F2N5O2/c1-11(2)16-23-15(26-24-16)6-7-21-17(20-3)22-8-9-25-14-5-4-12(18)10-13(14)19/h4-5,10-11H,6-9H2,1-3H3,(H2,20,21,22) |
| InChIKey | DPHCSFIYHLBDMM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|