C24H31N5O — CID 109389298
1-(2,3-diphenylpropyl)-2-methyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine (PubChem CID 109389298) has the molecular formula C24H31N5O and a molecular weight of 405.55 g/mol. Its IUPAC name is 1-(2,3-diphenylpropyl)-2-methyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine.
| Compound Name | 1-(2,3-diphenylpropyl)-2-methyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 109389298 |
| Molecular Formula | C24H31N5O |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 1-(2,3-diphenylpropyl)-2-methyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCc1nc(C(C)C)no1)NCC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31N5O/c1-18(2)23-28-22(30-29-23)14-15-26-24(25-3)27-17-21(20-12-8-5-9-13-20)16-19-10-6-4-7-11-19/h4-13,18,21H,14-17H2,1-3H3,(H2,25,26,27) |
| InChIKey | YQCDOZQXCPQGRD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|