C25H32N4O — CID 109389801
1-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-(2,3-diphenylpropyl)-2-methylguanidine (PubChem CID 109389801) has the molecular formula C25H32N4O and a molecular weight of 404.56 g/mol. Its IUPAC name is 1-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-(2,3-diphenylpropyl)-2-methylguanidine.
| Compound Name | 1-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-(2,3-diphenylpropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 109389801 |
| Molecular Formula | C25H32N4O |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 1-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-(2,3-diphenylpropyl)-2-methylguanidine |
| SMILES | C/N=C(\NCCCc1c(C)noc1C)NCC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H32N4O/c1-19-24(20(2)30-29-19)15-10-16-27-25(26-3)28-18-23(22-13-8-5-9-14-22)17-21-11-6-4-7-12-21/h4-9,11-14,23H,10,15-18H2,1-3H3,(H2,26,27,28) |
| InChIKey | MZVOPCMIRRHHRF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|