C20H23N3 — CID 109389814
1-(2,3-diphenylpropyl)-2-methyl-3-prop-2-ynylguanidine (PubChem CID 109389814) has the molecular formula C20H23N3 and a molecular weight of 305.43 g/mol. Its IUPAC name is 1-(2,3-diphenylpropyl)-2-methyl-3-prop-2-ynylguanidine.
| Compound Name | 1-(2,3-diphenylpropyl)-2-methyl-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 109389814 |
| Molecular Formula | C20H23N3 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 1-(2,3-diphenylpropyl)-2-methyl-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N\C)NCC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H23N3/c1-3-14-22-20(21-2)23-16-19(18-12-8-5-9-13-18)15-17-10-6-4-7-11-17/h1,4-13,19H,14-16H2,2H3,(H2,21,22,23) |
| InChIKey | PXJUAXLSIBIGGQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|