C13H17N3 — CID 110949098
2-methyl-1-(1-phenylethyl)-3-prop-2-ynylguanidine (PubChem CID 110949098) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-methyl-1-(1-phenylethyl)-3-prop-2-ynylguanidine.
| Compound Name | 2-methyl-1-(1-phenylethyl)-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 110949098 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 2-methyl-1-(1-phenylethyl)-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N\C)NC(C)c1ccccc1 |
| InChI | InChI=1S/C13H17N3/c1-4-10-15-13(14-3)16-11(2)12-8-6-5-7-9-12/h1,5-9,11H,10H2,2-3H3,(H2,14,15,16) |
| InChIKey | CGALNEVWKKCIKC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|