C23H26FIN4 — CID 109389380
1-(2,3-diphenylpropyl)-3-[(3-fluoro-2-pyridinyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 109389380) has the molecular formula C23H26FIN4 and a molecular weight of 504.39 g/mol. Its IUPAC name is 1-(2,3-diphenylpropyl)-3-[(3-fluoro-2-pyridinyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2,3-diphenylpropyl)-3-[(3-fluoro-2-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109389380 |
| Molecular Formula | C23H26FIN4 |
| Molecular Weight | 504.39 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 1-(2,3-diphenylpropyl)-3-[(3-fluoro-2-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ncccc1F)NCC(Cc1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C23H25FN4.HI/c1-25-23(28-17-22-21(24)13-8-14-26-22)27-16-20(19-11-6-3-7-12-19)15-18-9-4-2-5-10-18;/h2-14,20H,15-17H2,1H3,(H2,25,27,28);1H |
| InChIKey | QSFHGFZVAJFKMH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|