C27H34IN5O — CID 109389339
1-(2,3-diphenylpropyl)-2-methyl-3-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 109389339) has the molecular formula C27H34IN5O and a molecular weight of 571.51 g/mol. Its IUPAC name is 1-(2,3-diphenylpropyl)-2-methyl-3-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,3-diphenylpropyl)-2-methyl-3-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109389339 |
| Molecular Formula | C27H34IN5O |
| Molecular Weight | 571.51 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 1-(2,3-diphenylpropyl)-2-methyl-3-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccnc1N1CCOCC1)NCC(Cc1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C27H33N5O.HI/c1-28-27(30-20-24-13-8-14-29-26(24)32-15-17-33-18-16-32)31-21-25(23-11-6-3-7-12-23)19-22-9-4-2-5-10-22;/h2-14,25H,15-21H2,1H3,(H2,28,30,31);1H |
| InChIKey | IUFCMACDNYRYDB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|