C27H34N6 — CID 111356926
1-(2,2-diphenylethyl)-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 111356926) has the molecular formula C27H34N6 and a molecular weight of 442.61 g/mol. Its IUPAC name is 1-(2,2-diphenylethyl)-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-(2,2-diphenylethyl)-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111356926 |
| Molecular Formula | C27H34N6 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 1-(2,2-diphenylethyl)-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1cccnc1N1CCN(C)CC1)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H34N6/c1-28-27(30-20-24-14-9-15-29-26(24)33-18-16-32(2)17-19-33)31-21-25(22-10-5-3-6-11-22)23-12-7-4-8-13-23/h3-15,25H,16-21H2,1-2H3,(H2,28,30,31) |
| InChIKey | QFDLVQACCVUTCX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|