C19H28N6S — CID 111893585
2-methyl-1-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[(3-methylthiophen-2-yl)methyl]guanidine (PubChem CID 111893585) has the molecular formula C19H28N6S and a molecular weight of 372.54 g/mol. Its IUPAC name is 2-methyl-1-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[(3-methylthiophen-2-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[(3-methylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111893585 |
| Molecular Formula | C19H28N6S |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 2-methyl-1-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[(3-methylthiophen-2-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1cccnc1N1CCN(C)CC1)NCc1sccc1C |
| InChI | InChI=1S/C19H28N6S/c1-15-6-12-26-17(15)14-23-19(20-2)22-13-16-5-4-7-21-18(16)25-10-8-24(3)9-11-25/h4-7,12H,8-11,13-14H2,1-3H3,(H2,20,22,23) |
| InChIKey | XYRCAYMGUXZIDW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|