C18H27N7S — CID 111892421
2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine (PubChem CID 111892421) has the molecular formula C18H27N7S and a molecular weight of 373.53 g/mol. Its IUPAC name is 2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine.
| Compound Name | 2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111892421 |
| Molecular Formula | C18H27N7S |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
| SMILES | C/N=C(/NCCN1CCN(c2ncccn2)CC1)NCc1sccc1C |
| InChI | InChI=1S/C18H27N7S/c1-15-4-13-26-16(15)14-23-17(19-2)20-7-8-24-9-11-25(12-10-24)18-21-5-3-6-22-18/h3-6,13H,7-12,14H2,1-2H3,(H2,19,20,23) |
| InChIKey | DDDLGCYUGFYPNO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|