C18H28IN7S — CID 111940892
2-methyl-1-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-3-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111940892) has the molecular formula C18H28IN7S and a molecular weight of 501.44 g/mol. Its IUPAC name is 2-methyl-1-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-3-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111940892 |
| Molecular Formula | C18H28IN7S |
| Molecular Weight | 501.44 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 2-methyl-1-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCN(c2ncccn2)CC1)NCc1ccsc1.I |
| InChI | InChI=1S/C18H27N7S.HI/c1-19-17(23-14-16-4-13-26-15-16)20-7-3-8-24-9-11-25(12-10-24)18-21-5-2-6-22-18;/h2,4-6,13,15H,3,7-12,14H2,1H3,(H2,19,20,23);1H |
| InChIKey | MJBIAFJTBNCGHY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|