C21H29N7O2 — CID 111845493
1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111845493) has the molecular formula C21H29N7O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111845493 |
| Molecular Formula | C21H29N7O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCN1CCN(c2ncccn2)CC1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H29N7O2/c1-22-20(26-15-17-4-5-18-19(14-17)30-16-29-18)23-8-3-9-27-10-12-28(13-11-27)21-24-6-2-7-25-21/h2,4-7,14H,3,8-13,15-16H2,1H3,(H2,22,23,26) |
| InChIKey | KAFWMMRFHWGUIR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|