C19H27FIN7 — CID 111875956
1-[(3-fluorophenyl)methyl]-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 111875956) has the molecular formula C19H27FIN7 and a molecular weight of 499.38 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-fluorophenyl)methyl]-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111875956 |
| Molecular Formula | C19H27FIN7 |
| Molecular Weight | 499.38 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCN1CCN(c2ncccn2)CC1)NCc1cccc(F)c1.I |
| InChI | InChI=1S/C19H26FN7.HI/c1-21-18(25-15-16-4-2-5-17(20)14-16)22-8-9-26-10-12-27(13-11-26)19-23-6-3-7-24-19;/h2-7,14H,8-13,15H2,1H3,(H2,21,22,25);1H |
| InChIKey | ZVDJRLAWBGEKPL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|