C19H25FN6O — CID 55922334
1-[2-(3-fluorophenyl)ethyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]urea (PubChem CID 55922334) has the molecular formula C19H25FN6O and a molecular weight of 372.45 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)ethyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]urea.
| Compound Name | 1-[2-(3-fluorophenyl)ethyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 55922334 |
| Molecular Formula | C19H25FN6O |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 1-[2-(3-fluorophenyl)ethyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]urea |
| SMILES | O=C(NCCc1cccc(F)c1)NCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H25FN6O/c20-17-4-1-3-16(15-17)5-8-23-19(27)24-9-10-25-11-13-26(14-12-25)18-21-6-2-7-22-18/h1-4,6-7,15H,5,8-14H2,(H2,23,24,27) |
| InChIKey | KXMYTIBXMHKLAM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |