C20H28FN7 — CID 111230461
1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine (PubChem CID 111230461) has the molecular formula C20H28FN7 and a molecular weight of 385.49 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111230461 |
| Molecular Formula | C20H28FN7 |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCc1ccc(F)cc1)NCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C20H28FN7/c1-22-19(23-10-7-17-3-5-18(21)6-4-17)24-11-12-27-13-15-28(16-14-27)20-25-8-2-9-26-20/h2-6,8-9H,7,10-16H2,1H3,(H2,22,23,24) |
| InChIKey | VLMBPEGKOCGPAP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|