C20H28FN7 — CID 111307740
1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine (PubChem CID 111307740) has the molecular formula C20H28FN7 and a molecular weight of 385.49 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111307740 |
| Molecular Formula | C20H28FN7 |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
| SMILES | C/N=C(/NCCN1CCN(c2ncccn2)CC1)N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H28FN7/c1-22-19(26(2)16-17-4-6-18(21)7-5-17)25-10-11-27-12-14-28(15-13-27)20-23-8-3-9-24-20/h3-9H,10-16H2,1-2H3,(H,22,25) |
| InChIKey | AYTMBZKMFBMYKF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|