C21H32IN7S — CID 111299402
1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 111299402) has the molecular formula C21H32IN7S and a molecular weight of 541.51 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111299402 |
| Molecular Formula | C21H32IN7S |
| Molecular Weight | 541.51 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | 1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCN1CCN(c2ncccn2)CC1)N(C)Cc1ccc(SC)cc1.I |
| InChI | InChI=1S/C21H31N7S.HI/c1-22-20(26(2)17-18-5-7-19(29-3)8-6-18)25-11-12-27-13-15-28(16-14-27)21-23-9-4-10-24-21;/h4-10H,11-17H2,1-3H3,(H,22,25);1H |
| InChIKey | CTZUUWIQOGCCED-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|