C19H32IN5OS — CID 111299246
3-[2-(4-acetylpiperazin-1-yl)ethyl]-1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111299246) has the molecular formula C19H32IN5OS and a molecular weight of 505.47 g/mol. Its IUPAC name is 3-[2-(4-acetylpiperazin-1-yl)ethyl]-1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[2-(4-acetylpiperazin-1-yl)ethyl]-1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111299246 |
| Molecular Formula | C19H32IN5OS |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | 3-[2-(4-acetylpiperazin-1-yl)ethyl]-1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCN1CCN(C(C)=O)CC1)N(C)Cc1ccc(SC)cc1.I |
| InChI | InChI=1S/C19H31N5OS.HI/c1-16(25)24-13-11-23(12-14-24)10-9-21-19(20-2)22(3)15-17-5-7-18(26-4)8-6-17;/h5-8H,9-15H2,1-4H3,(H,20,21);1H |
| InChIKey | WDSMGLVOBSOFOB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|