C16H29IN6OS — CID 109423547
3-[2-(4-acetylpiperazin-1-yl)ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109423547) has the molecular formula C16H29IN6OS and a molecular weight of 480.42 g/mol. Its IUPAC name is 3-[2-(4-acetylpiperazin-1-yl)ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[2-(4-acetylpiperazin-1-yl)ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109423547 |
| Molecular Formula | C16H29IN6OS |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 3-[2-(4-acetylpiperazin-1-yl)ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCN1CCN(C(C)=O)CC1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C16H28N6OS.HI/c1-13-19-15(12-24-13)11-20(4)16(17-3)18-5-6-21-7-9-22(10-8-21)14(2)23;/h12H,5-11H2,1-4H3,(H,17,18);1H |
| InChIKey | IQEFEIIFEINYJX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|