C23H36N6S — CID 109422246
3-[4-(4-benzylpiperazin-1-yl)butyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109422246) has the molecular formula C23H36N6S and a molecular weight of 428.65 g/mol. Its IUPAC name is 3-[4-(4-benzylpiperazin-1-yl)butyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 3-[4-(4-benzylpiperazin-1-yl)butyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109422246 |
| Molecular Formula | C23H36N6S |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 3-[4-(4-benzylpiperazin-1-yl)butyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCCCN1CCN(Cc2ccccc2)CC1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C23H36N6S/c1-20-26-22(19-30-20)18-27(3)23(24-2)25-11-7-8-12-28-13-15-29(16-14-28)17-21-9-5-4-6-10-21/h4-6,9-10,19H,7-8,11-18H2,1-3H3,(H,24,25) |
| InChIKey | QSHOOLSHJGWEOB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 47.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|