C16H29N5OS — CID 109421030
1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(4-morpholin-4-ylbutyl)guanidine (PubChem CID 109421030) has the molecular formula C16H29N5OS and a molecular weight of 339.51 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(4-morpholin-4-ylbutyl)guanidine.
| Compound Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(4-morpholin-4-ylbutyl)guanidine |
|---|---|
| PubChem CID | 109421030 |
| Molecular Formula | C16H29N5OS |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(4-morpholin-4-ylbutyl)guanidine |
| SMILES | C/N=C(/NCCCCN1CCOCC1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C16H29N5OS/c1-14-19-15(13-23-14)12-20(3)16(17-2)18-6-4-5-7-21-8-10-22-11-9-21/h13H,4-12H2,1-3H3,(H,17,18) |
| InChIKey | DXLUZRPJOIPDEW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|