C13H22F3IN4S — CID 109423855
1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(5,5,5-trifluoropentyl)guanidine;hydroiodide (PubChem CID 109423855) has the molecular formula C13H22F3IN4S and a molecular weight of 450.31 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(5,5,5-trifluoropentyl)guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(5,5,5-trifluoropentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109423855 |
| Molecular Formula | C13H22F3IN4S |
| Molecular Weight | 450.31 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(5,5,5-trifluoropentyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCC(F)(F)F)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C13H21F3N4S.HI/c1-10-19-11(9-21-10)8-20(3)12(17-2)18-7-5-4-6-13(14,15)16;/h9H,4-8H2,1-3H3,(H,17,18);1H |
| InChIKey | DMZMCVCIGQGWDH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|