C12H24IN5O2S2 — CID 109425091
3-[3-(methanesulfonamido)propyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109425091) has the molecular formula C12H24IN5O2S2 and a molecular weight of 461.40 g/mol. Its IUPAC name is 3-[3-(methanesulfonamido)propyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[3-(methanesulfonamido)propyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109425091 |
| Molecular Formula | C12H24IN5O2S2 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | 3-[3-(methanesulfonamido)propyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCNS(C)(=O)=O)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C12H23N5O2S2.HI/c1-10-16-11(9-20-10)8-17(3)12(13-2)14-6-5-7-15-21(4,18)19;/h9,15H,5-8H2,1-4H3,(H,13,14);1H |
| InChIKey | CJVFOSUSHQNQNU-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|