C17H24N4O2S2 — CID 109422112
1,2-dimethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109422112) has the molecular formula C17H24N4O2S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 1,2-dimethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109422112 |
| Molecular Formula | C17H24N4O2S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1,2-dimethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCc1ccc(S(C)(=O)=O)cc1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C17H24N4O2S2/c1-13-20-15(12-24-13)11-21(3)17(18-2)19-10-9-14-5-7-16(8-6-14)25(4,22)23/h5-8,12H,9-11H2,1-4H3,(H,18,19) |
| InChIKey | MXGHKOYWPBVMHW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|