C20H30N4O2S2 — CID 109420806
3-[2-(4-tert-butylphenyl)sulfonylethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109420806) has the molecular formula C20H30N4O2S2 and a molecular weight of 422.62 g/mol. Its IUPAC name is 3-[2-(4-tert-butylphenyl)sulfonylethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 3-[2-(4-tert-butylphenyl)sulfonylethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109420806 |
| Molecular Formula | C20H30N4O2S2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 3-[2-(4-tert-butylphenyl)sulfonylethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCS(=O)(=O)c1ccc(C(C)(C)C)cc1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C20H30N4O2S2/c1-15-23-17(14-27-15)13-24(6)19(21-5)22-11-12-28(25,26)18-9-7-16(8-10-18)20(2,3)4/h7-10,14H,11-13H2,1-6H3,(H,21,22) |
| InChIKey | FGHOKLHSFKWURS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|