C14H28IN5S — CID 109424489
3-[2-(tert-butylamino)ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109424489) has the molecular formula C14H28IN5S and a molecular weight of 425.38 g/mol. Its IUPAC name is 3-[2-(tert-butylamino)ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[2-(tert-butylamino)ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109424489 |
| Molecular Formula | C14H28IN5S |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 3-[2-(tert-butylamino)ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCNC(C)(C)C)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C14H27N5S.HI/c1-11-18-12(10-20-11)9-19(6)13(15-5)16-7-8-17-14(2,3)4;/h10,17H,7-9H2,1-6H3,(H,15,16);1H |
| InChIKey | QBCBOKXFWKFXAB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|