C18H23F3IN5OS — CID 109421671
N-[2-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide (PubChem CID 109421671) has the molecular formula C18H23F3IN5OS and a molecular weight of 541.38 g/mol. Its IUPAC name is N-[2-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide.
| Compound Name | N-[2-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide |
|---|---|
| PubChem CID | 109421671 |
| Molecular Formula | C18H23F3IN5OS |
| Molecular Weight | 541.38 g/mol |
| Exact Mass | 541.06 |
| IUPAC Name | N-[2-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide |
| SMILES | C/N=C(/NCCNC(=O)c1ccc(C(F)(F)F)cc1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C18H22F3N5OS.HI/c1-12-25-15(11-28-12)10-26(3)17(22-2)24-9-8-23-16(27)13-4-6-14(7-5-13)18(19,20)21;/h4-7,11H,8-10H2,1-3H3,(H,22,24)(H,23,27);1H |
| InChIKey | IYZVMQOXLYTXEK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|